About 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol
2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol (PubChem CID 71498497) has the molecular formula C12H22OS
and a molecular weight of 214.37 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol.
Molecular Properties
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol |
| PubChem CID | 71498497 |
| Molecular Formula | C12H22OS |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol |
| SMILES | CC(C)=CCC/C(C)=C/CSCCO |
| InChI | InChI=1S/C12H22OS/c1-11(2)5-4-6-12(3)7-9-14-10-8-13/h5,7,13H,4,6,8-10H2,1-3H3/b12-7+ |
| InChIKey | UURZZPVRNJSPOS-KPKJPENVSA-N |
| XLogP | 3.40 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol?
The IUPAC name of 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol (CID 71498497) is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol.
What is the SMILES notation for 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol?
The canonical SMILES for 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol is CC(C)=CCC/C(C)=C/CSCCO.
What is the InChIKey of 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol?
The InChIKey is UURZZPVRNJSPOS-KPKJPENVSA-N. The full InChI is InChI=1S/C12H22OS/c1-11(2)5-4-6-12(3)7-9-14-10-8-13/h5,7,13H,4,6,8-10H2,1-3H3/b12-7+.
What are the key properties of 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol?
2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol has a molecular weight of 214.37 g/mol, XLogP of 3.40, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E)-3,7-dimethylocta-2,6-dienyl]sulfanylethanol is sourced from PubChem (CID 71498497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).