C22H38OS — CID 71498498
2-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylethanol (PubChem CID 71498498) has the molecular formula C22H38OS and a molecular weight of 350.61 g/mol. Its IUPAC name is 2-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylethanol.
| Compound Name | 2-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylethanol |
|---|---|
| PubChem CID | 71498498 |
| Molecular Formula | C22H38OS |
| Molecular Weight | 350.61 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | 2-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylethanol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CSCCO |
| InChI | InChI=1S/C22H38OS/c1-19(2)9-6-10-20(3)11-7-12-21(4)13-8-14-22(5)15-17-24-18-16-23/h9,11,13,15,23H,6-8,10,12,14,16-18H2,1-5H3/b20-11+,21-13+,22-15+ |
| InChIKey | FHPOZQMLTNNPRF-FLPKSHQQSA-N |
| XLogP | 6.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.61 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|