C28H22O5 — CID 71498515
10-(4-hydroxyphenyl)-3-[(Z)-2-(4-hydroxyphenyl)ethenyl]-9,10-dihydrophenanthrene-1,5,7-triol (PubChem CID 71498515) has the molecular formula C28H22O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is 10-(4-hydroxyphenyl)-3-[(Z)-2-(4-hydroxyphenyl)ethenyl]-9,10-dihydrophenanthrene-1,5,7-triol.
| Compound Name | 10-(4-hydroxyphenyl)-3-[(Z)-2-(4-hydroxyphenyl)ethenyl]-9,10-dihydrophenanthrene-1,5,7-triol |
|---|---|
| PubChem CID | 71498515 |
| Molecular Formula | C28H22O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 10-(4-hydroxyphenyl)-3-[(Z)-2-(4-hydroxyphenyl)ethenyl]-9,10-dihydrophenanthrene-1,5,7-triol |
| SMILES | Oc1ccc(/C=C\c2cc(O)c3c(c2)-c2c(O)cc(O)cc2CC3c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C28H22O5/c29-20-7-3-16(4-8-20)1-2-17-11-24-27-19(13-22(31)15-26(27)33)14-23(28(24)25(32)12-17)18-5-9-21(30)10-6-18/h1-13,15,23,29-33H,14H2/b2-1- |
| InChIKey | DYBGHDULJVDVSO-UPHRSURJSA-N |
| XLogP | 5.74 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|