C28H19F3N4O3S — CID 71498638
3-[4-[4-[4-[(2,3,5-trifluorophenyl)carbamoylamino]phenyl]thieno[3,2-d]pyrimidin-7-yl]phenyl]propanoic acid (PubChem CID 71498638) has the molecular formula C28H19F3N4O3S and a molecular weight of 548.55 g/mol. Its IUPAC name is 3-[4-[4-[4-[(2,3,5-trifluorophenyl)carbamoylamino]phenyl]thieno[3,2-d]pyrimidin-7-yl]phenyl]propanoic acid.
| Compound Name | 3-[4-[4-[4-[(2,3,5-trifluorophenyl)carbamoylamino]phenyl]thieno[3,2-d]pyrimidin-7-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 71498638 |
| Molecular Formula | C28H19F3N4O3S |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 3-[4-[4-[4-[(2,3,5-trifluorophenyl)carbamoylamino]phenyl]thieno[3,2-d]pyrimidin-7-yl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(-c2csc3c(-c4ccc(NC(=O)Nc5cc(F)cc(F)c5F)cc4)ncnc23)cc1 |
| InChI | InChI=1S/C28H19F3N4O3S/c29-18-11-21(30)24(31)22(12-18)35-28(38)34-19-8-6-17(7-9-19)25-27-26(33-14-32-25)20(13-39-27)16-4-1-15(2-5-16)3-10-23(36)37/h1-2,4-9,11-14H,3,10H2,(H,36,37)(H2,34,35,38) |
| InChIKey | KLBOKZFFXJTXMN-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|