C22H27ClN2 — CID 71498954
4-[(1R,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazine (PubChem CID 71498954) has the molecular formula C22H27ClN2 and a molecular weight of 359.96 g/mol. Its IUPAC name is 4-[(1R,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazine.
| Compound Name | 4-[(1R,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazine |
|---|---|
| PubChem CID | 71498954 |
| Molecular Formula | C22H27ClN2 |
| Molecular Weight | 359.96 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 4-[(1R,3S)-6-chloro-3-(2,3,4,5,6-pentadeuteriophenyl)-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazine |
| SMILES | [2H]c1c([2H])c([2H])c([C@@H]2C[C@@H](N3CCN(C)C(C)(C)C3)c3cc(Cl)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C22H27ClN2/c1-22(2)15-25(12-11-24(22)3)21-14-19(16-7-5-4-6-8-16)18-10-9-17(23)13-20(18)21/h4-10,13,19,21H,11-12,14-15H2,1-3H3/t19-,21+/m0/s1/i4D,5D,6D,7D,8D |
| InChIKey | BYPMJBXPNZMNQD-HKVKHNQNSA-N |
| XLogP | 4.94 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.96 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |