C20H23FN6O2 — CID 71499004
6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-7-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one (PubChem CID 71499004) has the molecular formula C20H23FN6O2 and a molecular weight of 398.44 g/mol. Its IUPAC name is 6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-7-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one.
| Compound Name | 6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-7-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 71499004 |
| Molecular Formula | C20H23FN6O2 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 6-[[(1R,2S)-2-aminocyclohexyl]amino]-7-fluoro-4-(1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-7-yl)-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
| SMILES | N[C@H]1CCCC[C@H]1Nc1nc(-c2cc3n(c2)CCNC3=O)c2c(c1F)CNC2=O |
| InChI | InChI=1S/C20H23FN6O2/c21-16-11-8-24-20(29)15(11)17(10-7-14-19(28)23-5-6-27(14)9-10)26-18(16)25-13-4-2-1-3-12(13)22/h7,9,12-13H,1-6,8,22H2,(H,23,28)(H,24,29)(H,25,26)/t12-,13+/m0/s1 |
| InChIKey | RJDDTLCPSXBIPF-QWHCGFSZSA-N |
| XLogP | 1.36 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |