C28H48O5Si — CID 71499450
(1S,5R,7S,8S)-7-hydroxy-4-methoxy-8-methyl-5-(3-methylbut-2-enyl)-8-(4-methyl-4-triethylsilyloxypentyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 71499450) has the molecular formula C28H48O5Si and a molecular weight of 492.77 g/mol. Its IUPAC name is (1S,5R,7S,8S)-7-hydroxy-4-methoxy-8-methyl-5-(3-methylbut-2-enyl)-8-(4-methyl-4-triethylsilyloxypentyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1S,5R,7S,8S)-7-hydroxy-4-methoxy-8-methyl-5-(3-methylbut-2-enyl)-8-(4-methyl-4-triethylsilyloxypentyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 71499450 |
| Molecular Formula | C28H48O5Si |
| Molecular Weight | 492.77 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | (1S,5R,7S,8S)-7-hydroxy-4-methoxy-8-methyl-5-(3-methylbut-2-enyl)-8-(4-methyl-4-triethylsilyloxypentyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | CC[Si](CC)(CC)OC(C)(C)CCC[C@@]1(C)[C@H]2C(=O)C=C(OC)[C@@](CC=C(C)C)(C[C@@H]1O)C2=O |
| InChI | InChI=1S/C28H48O5Si/c1-10-34(11-2,12-3)33-26(6,7)15-13-16-27(8)22(30)19-28(17-14-20(4)5)23(32-9)18-21(29)24(27)25(28)31/h14,18,22,24,30H,10-13,15-17,19H2,1-9H3/t22-,24-,27+,28+/m0/s1 |
| InChIKey | SJOGFKGTKZDDHI-YRLQWRJRSA-N |
| XLogP | 6.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.77 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|