C21H31NO3 — CID 71499784
(E,1S,2S)-2-(tert-butylamino)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylbut-3-en-1-ol (PubChem CID 71499784) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is (E,1S,2S)-2-(tert-butylamino)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylbut-3-en-1-ol.
| Compound Name | (E,1S,2S)-2-(tert-butylamino)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylbut-3-en-1-ol |
|---|---|
| PubChem CID | 71499784 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | (E,1S,2S)-2-(tert-butylamino)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-phenylbut-3-en-1-ol |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1[C@@H](O)[C@H](/C=C/c1ccccc1)NC(C)(C)C |
| InChI | InChI=1S/C21H31NO3/c1-7-17-19(25-21(5,6)24-17)18(23)16(22-20(2,3)4)14-13-15-11-9-8-10-12-15/h7-14,16-19,22-23H,1H2,2-6H3/b14-13+/t16-,17-,18-,19-/m0/s1 |
| InChIKey | HSNFOUFXGHYWII-XHERKDLZSA-N |
| XLogP | 3.52 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|