C16H18O — CID 71499800
10-methoxy-9-methyl-1,2,3,4-tetrahydrophenanthrene (PubChem CID 71499800) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 10-methoxy-9-methyl-1,2,3,4-tetrahydrophenanthrene.
| Compound Name | 10-methoxy-9-methyl-1,2,3,4-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 71499800 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 10-methoxy-9-methyl-1,2,3,4-tetrahydrophenanthrene |
| SMILES | COc1c2c(c3ccccc3c1C)CCCC2 |
| InChI | InChI=1S/C16H18O/c1-11-12-7-3-4-8-13(12)14-9-5-6-10-15(14)16(11)17-2/h3-4,7-8H,5-6,9-10H2,1-2H3 |
| InChIKey | FPRXGGFXFADYEX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |