C19H26ClNO2 — CID 71499930
ethyl (1Z)-2-[2-(4-chlorophenyl)ethylamino]cyclooctene-1-carboxylate (PubChem CID 71499930) has the molecular formula C19H26ClNO2 and a molecular weight of 335.88 g/mol. Its IUPAC name is ethyl (1Z)-2-[2-(4-chlorophenyl)ethylamino]cyclooctene-1-carboxylate.
| Compound Name | ethyl (1Z)-2-[2-(4-chlorophenyl)ethylamino]cyclooctene-1-carboxylate |
|---|---|
| PubChem CID | 71499930 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | ethyl (1Z)-2-[2-(4-chlorophenyl)ethylamino]cyclooctene-1-carboxylate |
| SMILES | CCOC(=O)/C1=C(\NCCc2ccc(Cl)cc2)CCCCCC1 |
| InChI | InChI=1S/C19H26ClNO2/c1-2-23-19(22)17-7-5-3-4-6-8-18(17)21-14-13-15-9-11-16(20)12-10-15/h9-12,21H,2-8,13-14H2,1H3/b18-17- |
| InChIKey | JMTOVEHPBHFQAI-ZCXUNETKSA-N |
| XLogP | 4.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |