C20H21Cl2N5O2 — CID 71499990
4-[[4-(2-chloroanilino)pyrimidin-2-yl]amino]-N-(2-methoxyethyl)benzamide;hydrochloride (PubChem CID 71499990) has the molecular formula C20H21Cl2N5O2 and a molecular weight of 434.33 g/mol. Its IUPAC name is 4-[[4-(2-chloroanilino)pyrimidin-2-yl]amino]-N-(2-methoxyethyl)benzamide;hydrochloride.
| Compound Name | 4-[[4-(2-chloroanilino)pyrimidin-2-yl]amino]-N-(2-methoxyethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 71499990 |
| Molecular Formula | C20H21Cl2N5O2 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 4-[[4-(2-chloroanilino)pyrimidin-2-yl]amino]-N-(2-methoxyethyl)benzamide;hydrochloride |
| SMILES | COCCNC(=O)c1ccc(Nc2nccc(Nc3ccccc3Cl)n2)cc1.Cl |
| InChI | InChI=1S/C20H20ClN5O2.ClH/c1-28-13-12-22-19(27)14-6-8-15(9-7-14)24-20-23-11-10-18(26-20)25-17-5-3-2-4-16(17)21;/h2-11H,12-13H2,1H3,(H,22,27)(H2,23,24,25,26);1H |
| InChIKey | ZOMWYRGWIYHLGP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|