C27H24ClN3O — CID 71500164
(1R,16R)-13-benzyl-16-(3-chlorophenyl)-2,10,13-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,11(15)-tetraen-12-one (PubChem CID 71500164) has the molecular formula C27H24ClN3O and a molecular weight of 441.96 g/mol. Its IUPAC name is (1R,16R)-13-benzyl-16-(3-chlorophenyl)-2,10,13-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,11(15)-tetraen-12-one.
| Compound Name | (1R,16R)-13-benzyl-16-(3-chlorophenyl)-2,10,13-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,11(15)-tetraen-12-one |
|---|---|
| PubChem CID | 71500164 |
| Molecular Formula | C27H24ClN3O |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | (1R,16R)-13-benzyl-16-(3-chlorophenyl)-2,10,13-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-3,5,7,11(15)-tetraen-12-one |
| SMILES | O=C1C2=C(CN1Cc1ccccc1)[C@@H](c1cccc(Cl)c1)C[C@@H]1Nc3ccccc3CN21 |
| InChI | InChI=1S/C27H24ClN3O/c28-21-11-6-10-19(13-21)22-14-25-29-24-12-5-4-9-20(24)16-31(25)26-23(22)17-30(27(26)32)15-18-7-2-1-3-8-18/h1-13,22,25,29H,14-17H2/t22-,25-/m1/s1 |
| InChIKey | CAHDFVKWJIPKOJ-RCZVLFRGSA-N |
| XLogP | 5.38 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |