C10H10N6O4 — CID 71500752
4,6-dimethoxy-N-(5-nitro-2-pyridinyl)-1,3,5-triazin-2-amine (PubChem CID 71500752) has the molecular formula C10H10N6O4 and a molecular weight of 278.23 g/mol. Its IUPAC name is 4,6-dimethoxy-N-(5-nitro-2-pyridinyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dimethoxy-N-(5-nitro-2-pyridinyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 71500752 |
| Molecular Formula | C10H10N6O4 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4,6-dimethoxy-N-(5-nitro-2-pyridinyl)-1,3,5-triazin-2-amine |
| SMILES | COc1nc(Nc2ccc([N+](=O)[O-])cn2)nc(OC)n1 |
| InChI | InChI=1S/C10H10N6O4/c1-19-9-13-8(14-10(15-9)20-2)12-7-4-3-6(5-11-7)16(17)18/h3-5H,1-2H3,(H,11,12,13,14,15) |
| InChIKey | BZEUENKBTOKQGH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|