C32H46F3N3O3Si — CID 71500860
(2S,3S)-N-[(1R)-1-[[3-(butylamino)-3-oxopropyl]-diphenylsilyl]-3-methylbutyl]-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanamide (PubChem CID 71500860) has the molecular formula C32H46F3N3O3Si and a molecular weight of 605.82 g/mol. Its IUPAC name is (2S,3S)-N-[(1R)-1-[[3-(butylamino)-3-oxopropyl]-diphenylsilyl]-3-methylbutyl]-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanamide.
| Compound Name | (2S,3S)-N-[(1R)-1-[[3-(butylamino)-3-oxopropyl]-diphenylsilyl]-3-methylbutyl]-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 71500860 |
| Molecular Formula | C32H46F3N3O3Si |
| Molecular Weight | 605.82 g/mol |
| Exact Mass | 605.33 |
| IUPAC Name | (2S,3S)-N-[(1R)-1-[[3-(butylamino)-3-oxopropyl]-diphenylsilyl]-3-methylbutyl]-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanamide |
| SMILES | CCCCNC(=O)CC[Si](c1ccccc1)(c1ccccc1)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)C(F)(F)F)[C@@H](C)CC |
| InChI | InChI=1S/C32H46F3N3O3Si/c1-6-8-20-36-27(39)19-21-42(25-15-11-9-12-16-25,26-17-13-10-14-18-26)28(22-23(3)4)37-30(40)29(24(5)7-2)38-31(41)32(33,34)35/h9-18,23-24,28-29H,6-8,19-22H2,1-5H3,(H,36,39)(H,37,40)(H,38,41)/t24-,28+,29-/m0/s1 |
| InChIKey | HWCZLMKLFADABW-DOUMQJFESA-N |
| XLogP | 4.72 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.82 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|