C39H36BrN3O5S — CID 71501119
N-[[(2R,3R,4R)-3-(4-bromophenyl)-1-prop-2-enyl-4-(trityloxymethyl)azetidin-2-yl]methyl]-2-nitrobenzenesulfonamide (PubChem CID 71501119) has the molecular formula C39H36BrN3O5S and a molecular weight of 738.70 g/mol. Its IUPAC name is N-[[(2R,3R,4R)-3-(4-bromophenyl)-1-prop-2-enyl-4-(trityloxymethyl)azetidin-2-yl]methyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[[(2R,3R,4R)-3-(4-bromophenyl)-1-prop-2-enyl-4-(trityloxymethyl)azetidin-2-yl]methyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 71501119 |
| Molecular Formula | C39H36BrN3O5S |
| Molecular Weight | 738.70 g/mol |
| Exact Mass | 737.16 |
| IUPAC Name | N-[[(2R,3R,4R)-3-(4-bromophenyl)-1-prop-2-enyl-4-(trityloxymethyl)azetidin-2-yl]methyl]-2-nitrobenzenesulfonamide |
| SMILES | C=CCN1[C@@H](CNS(=O)(=O)c2ccccc2[N+](=O)[O-])[C@@H](c2ccc(Br)cc2)[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H36BrN3O5S/c1-2-26-42-35(27-41-49(46,47)37-21-13-12-20-34(37)43(44)45)38(29-22-24-33(40)25-23-29)36(42)28-48-39(30-14-6-3-7-15-30,31-16-8-4-9-17-31)32-18-10-5-11-19-32/h2-25,35-36,38,41H,1,26-28H2/t35-,36-,38+/m0/s1 |
| InChIKey | AGPZGMMUKSQBNY-CYAOVYSGSA-N |
| XLogP | 7.67 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.70 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|