C25H37NO6 — CID 71501149
2-[(3R,4aS,5S,7S)-7-tert-butyl-1-[2-(cyclohexen-1-yl)ethyl]-4a-methoxycarbonyl-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridin-3-yl]acetic acid (PubChem CID 71501149) has the molecular formula C25H37NO6 and a molecular weight of 447.57 g/mol. Its IUPAC name is 2-[(3R,4aS,5S,7S)-7-tert-butyl-1-[2-(cyclohexen-1-yl)ethyl]-4a-methoxycarbonyl-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4aS,5S,7S)-7-tert-butyl-1-[2-(cyclohexen-1-yl)ethyl]-4a-methoxycarbonyl-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 71501149 |
| Molecular Formula | C25H37NO6 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 2-[(3R,4aS,5S,7S)-7-tert-butyl-1-[2-(cyclohexen-1-yl)ethyl]-4a-methoxycarbonyl-5-methyl-2-oxo-3,4,5,7-tetrahydropyrano[4,3-b]pyridin-3-yl]acetic acid |
| SMILES | COC(=O)[C@@]12C[C@H](CC(=O)O)C(=O)N(CCC3=CCCCC3)C1=C[C@@H](C(C)(C)C)O[C@H]2C |
| InChI | InChI=1S/C25H37NO6/c1-16-25(23(30)31-5)15-18(13-21(27)28)22(29)26(12-11-17-9-7-6-8-10-17)19(25)14-20(32-16)24(2,3)4/h9,14,16,18,20H,6-8,10-13,15H2,1-5H3,(H,27,28)/t16-,18-,20-,25+/m0/s1 |
| InChIKey | PVFNPGSKYXFQJM-CGOGLYEHSA-N |
| XLogP | 4.08 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|