C19H15BF2N2S2 — CID 71501166
2,2-difluoro-5,11-dimethyl-4,12-dithiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 71501166) has the molecular formula C19H15BF2N2S2 and a molecular weight of 384.29 g/mol. Its IUPAC name is 2,2-difluoro-5,11-dimethyl-4,12-dithiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-5,11-dimethyl-4,12-dithiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 71501166 |
| Molecular Formula | C19H15BF2N2S2 |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2,2-difluoro-5,11-dimethyl-4,12-dithiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=CC2=Cc3cc(C)c(-c4cccs4)n3[B-](F)(F)[N+]2=C1c1cccs1 |
| InChI | InChI=1S/C19H15BF2N2S2/c1-12-9-14-11-15-10-13(2)19(17-6-4-8-26-17)24(15)20(21,22)23(14)18(12)16-5-3-7-25-16/h3-11H,1-2H3 |
| InChIKey | UDCNJKVTQMHOOH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|