About 3-hydroxy-6-methoxy-1,3-benzoxazol-2-one
3-hydroxy-6-methoxy-1,3-benzoxazol-2-one (PubChem CID 71501239) has the molecular formula C8H7NO4
and a molecular weight of 181.15 g/mol. Its IUPAC name is 3-hydroxy-6-methoxy-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-hydroxy-6-methoxy-1,3-benzoxazol-2-one |
| PubChem CID | 71501239 |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 3-hydroxy-6-methoxy-1,3-benzoxazol-2-one |
| SMILES | COc1ccc2c(c1)oc(=O)n2O |
| InChI | InChI=1S/C8H7NO4/c1-12-5-2-3-6-7(4-5)13-8(10)9(6)11/h2-4,11H,1H3 |
| InChIKey | FVIRQAIBLUSWMQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-6-methoxy-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-6-methoxy-1,3-benzoxazol-2-one?
The IUPAC name of 3-hydroxy-6-methoxy-1,3-benzoxazol-2-one (CID 71501239) is 3-hydroxy-6-methoxy-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-hydroxy-6-methoxy-1,3-benzoxazol-2-one?
The canonical SMILES for 3-hydroxy-6-methoxy-1,3-benzoxazol-2-one is COc1ccc2c(c1)oc(=O)n2O.
What is the InChIKey of 3-hydroxy-6-methoxy-1,3-benzoxazol-2-one?
The InChIKey is FVIRQAIBLUSWMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO4/c1-12-5-2-3-6-7(4-5)13-8(10)9(6)11/h2-4,11H,1H3.
What are the key properties of 3-hydroxy-6-methoxy-1,3-benzoxazol-2-one?
3-hydroxy-6-methoxy-1,3-benzoxazol-2-one has a molecular weight of 181.15 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-6-methoxy-1,3-benzoxazol-2-one is sourced from PubChem (CID 71501239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).