C50H78N8O16 — CID 71502032
1,4-bis[1-[1,3-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl]triazol-4-yl]phenazine (PubChem CID 71502032) has the molecular formula C50H78N8O16 and a molecular weight of 1047.21 g/mol. Its IUPAC name is 1,4-bis[1-[1,3-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl]triazol-4-yl]phenazine.
| Compound Name | 1,4-bis[1-[1,3-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl]triazol-4-yl]phenazine |
|---|---|
| PubChem CID | 71502032 |
| Molecular Formula | C50H78N8O16 |
| Molecular Weight | 1047.21 g/mol |
| Exact Mass | 1046.55 |
| IUPAC Name | 1,4-bis[1-[1,3-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propan-2-yl]triazol-4-yl]phenazine |
| SMILES | COCCOCCOCCOCC(COCCOCCOCCOC)n1cc(-c2ccc(-c3cn(C(COCCOCCOCCOC)COCCOCCOCCOC)nn3)c3nc4ccccc4nc23)nn1 |
| InChI | InChI=1S/C50H78N8O16/c1-59-11-15-63-19-23-67-27-31-71-37-41(38-72-32-28-68-24-20-64-16-12-60-2)57-35-47(53-55-57)43-9-10-44(50-49(43)51-45-7-5-6-8-46(45)52-50)48-36-58(56-54-48)42(39-73-33-29-69-25-21-65-17-13-61-3)40-74-34-30-70-26-22-66-18-14-62-4/h5-10,35-36,41-42H,11-34,37-40H2,1-4H3 |
| InChIKey | IHCBGUACXPYUJG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 234.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|