C31H32N4O5 — CID 71502409
oxolan-2-ylmethyl 3-[4-[1-[3-(dimethylamino)propyl]indol-3-yl]-2,5-dioxopyrrol-3-yl]-1H-indole-7-carboxylate (PubChem CID 71502409) has the molecular formula C31H32N4O5 and a molecular weight of 540.62 g/mol. Its IUPAC name is oxolan-2-ylmethyl 3-[4-[1-[3-(dimethylamino)propyl]indol-3-yl]-2,5-dioxopyrrol-3-yl]-1H-indole-7-carboxylate.
| Compound Name | oxolan-2-ylmethyl 3-[4-[1-[3-(dimethylamino)propyl]indol-3-yl]-2,5-dioxopyrrol-3-yl]-1H-indole-7-carboxylate |
|---|---|
| PubChem CID | 71502409 |
| Molecular Formula | C31H32N4O5 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | oxolan-2-ylmethyl 3-[4-[1-[3-(dimethylamino)propyl]indol-3-yl]-2,5-dioxopyrrol-3-yl]-1H-indole-7-carboxylate |
| SMILES | CN(C)CCCn1cc(C2=C(c3c[nH]c4c(C(=O)OCC5CCCO5)cccc34)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C31H32N4O5/c1-34(2)13-7-14-35-17-24(20-9-3-4-12-25(20)35)27-26(29(36)33-30(27)37)23-16-32-28-21(23)10-5-11-22(28)31(38)40-18-19-8-6-15-39-19/h3-5,9-12,16-17,19,32H,6-8,13-15,18H2,1-2H3,(H,33,36,37) |
| InChIKey | ZJBRVRSSEPVFIY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|