C28H24ClF3N6O — CID 71502447
3-[2-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethynyl]-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 71502447) has the molecular formula C28H24ClF3N6O and a molecular weight of 552.99 g/mol. Its IUPAC name is 3-[2-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethynyl]-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[2-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethynyl]-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 71502447 |
| Molecular Formula | C28H24ClF3N6O |
| Molecular Weight | 552.99 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | 3-[2-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethynyl]-N-[4-[(4-methylpiperazin-1-yl)methyl]-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CN1CCN(Cc2ccc(NC(=O)c3cccc(C#Cc4nnc5cccc(Cl)n45)c3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C28H24ClF3N6O/c1-36-12-14-37(15-13-36)18-21-9-10-22(17-23(21)28(30,31)32)33-27(39)20-5-2-4-19(16-20)8-11-26-35-34-25-7-3-6-24(29)38(25)26/h2-7,9-10,16-17H,12-15,18H2,1H3,(H,33,39) |
| InChIKey | OURWIILDQHORHK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 65.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.99 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|