C33H33N7O5S — CID 71502451
3-[4-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]-2,5-dioxopyrrol-3-yl]-N-[3-(2-oxooxolan-3-yl)sulfanylpropyl]-1H-indole-7-carboxamide (PubChem CID 71502451) has the molecular formula C33H33N7O5S and a molecular weight of 639.74 g/mol. Its IUPAC name is 3-[4-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]-2,5-dioxopyrrol-3-yl]-N-[3-(2-oxooxolan-3-yl)sulfanylpropyl]-1H-indole-7-carboxamide.
| Compound Name | 3-[4-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]-2,5-dioxopyrrol-3-yl]-N-[3-(2-oxooxolan-3-yl)sulfanylpropyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 71502451 |
| Molecular Formula | C33H33N7O5S |
| Molecular Weight | 639.74 g/mol |
| Exact Mass | 639.23 |
| IUPAC Name | 3-[4-[2-(4-methylpiperazin-1-yl)quinazolin-4-yl]-2,5-dioxopyrrol-3-yl]-N-[3-(2-oxooxolan-3-yl)sulfanylpropyl]-1H-indole-7-carboxamide |
| SMILES | CN1CCN(c2nc(C3=C(c4c[nH]c5c(C(=O)NCCCSC6CCOC6=O)cccc45)C(=O)NC3=O)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C33H33N7O5S/c1-39-12-14-40(15-13-39)33-36-23-9-3-2-6-20(23)28(37-33)26-25(30(42)38-31(26)43)22-18-35-27-19(22)7-4-8-21(27)29(41)34-11-5-17-46-24-10-16-45-32(24)44/h2-4,6-9,18,24,35H,5,10-17H2,1H3,(H,34,41)(H,38,42,43) |
| InChIKey | LWUJSPQNLHYTED-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 149.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.74 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|