C30H34N6O3 — CID 71502499
1-benzyl-N-(3-morpholin-4-ylpropyl)-5-(pyridin-3-ylmethylcarbamoylamino)indole-3-carboxamide (PubChem CID 71502499) has the molecular formula C30H34N6O3 and a molecular weight of 526.64 g/mol. Its IUPAC name is 1-benzyl-N-(3-morpholin-4-ylpropyl)-5-(pyridin-3-ylmethylcarbamoylamino)indole-3-carboxamide.
| Compound Name | 1-benzyl-N-(3-morpholin-4-ylpropyl)-5-(pyridin-3-ylmethylcarbamoylamino)indole-3-carboxamide |
|---|---|
| PubChem CID | 71502499 |
| Molecular Formula | C30H34N6O3 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 1-benzyl-N-(3-morpholin-4-ylpropyl)-5-(pyridin-3-ylmethylcarbamoylamino)indole-3-carboxamide |
| SMILES | O=C(NCc1cccnc1)Nc1ccc2c(c1)c(C(=O)NCCCN1CCOCC1)cn2Cc1ccccc1 |
| InChI | InChI=1S/C30H34N6O3/c37-29(32-12-5-13-35-14-16-39-17-15-35)27-22-36(21-23-6-2-1-3-7-23)28-10-9-25(18-26(27)28)34-30(38)33-20-24-8-4-11-31-19-24/h1-4,6-11,18-19,22H,5,12-17,20-21H2,(H,32,37)(H2,33,34,38) |
| InChIKey | QDAWMMAAKMLILV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|