C20H15N7O3 — CID 71502531
N-(4-methoxypyrimidin-5-yl)-3-[2-(6-methoxy-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)ethynyl]benzamide (PubChem CID 71502531) has the molecular formula C20H15N7O3 and a molecular weight of 401.39 g/mol. Its IUPAC name is N-(4-methoxypyrimidin-5-yl)-3-[2-(6-methoxy-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)ethynyl]benzamide.
| Compound Name | N-(4-methoxypyrimidin-5-yl)-3-[2-(6-methoxy-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)ethynyl]benzamide |
|---|---|
| PubChem CID | 71502531 |
| Molecular Formula | C20H15N7O3 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-(4-methoxypyrimidin-5-yl)-3-[2-(6-methoxy-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)ethynyl]benzamide |
| SMILES | COc1cn2c(C#Cc3cccc(C(=O)Nc4cncnc4OC)c3)nnc2cn1 |
| InChI | InChI=1S/C20H15N7O3/c1-29-18-11-27-16(25-26-17(27)10-22-18)7-6-13-4-3-5-14(8-13)19(28)24-15-9-21-12-23-20(15)30-2/h3-5,8-12H,1-2H3,(H,24,28) |
| InChIKey | CICINFJRIAOROI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|