C23H21F2N5O2 — CID 71502961
3-[(2R,5R)-5-(6,7-difluoro-1,3-benzoxazol-2-yl)-2-methylpiperidin-1-yl]-5-methyl-2-(triazol-2-yl)benzaldehyde (PubChem CID 71502961) has the molecular formula C23H21F2N5O2 and a molecular weight of 437.45 g/mol. Its IUPAC name is 3-[(2R,5R)-5-(6,7-difluoro-1,3-benzoxazol-2-yl)-2-methylpiperidin-1-yl]-5-methyl-2-(triazol-2-yl)benzaldehyde.
| Compound Name | 3-[(2R,5R)-5-(6,7-difluoro-1,3-benzoxazol-2-yl)-2-methylpiperidin-1-yl]-5-methyl-2-(triazol-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 71502961 |
| Molecular Formula | C23H21F2N5O2 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 3-[(2R,5R)-5-(6,7-difluoro-1,3-benzoxazol-2-yl)-2-methylpiperidin-1-yl]-5-methyl-2-(triazol-2-yl)benzaldehyde |
| SMILES | Cc1cc(C=O)c(-n2nccn2)c(N2C[C@H](c3nc4ccc(F)c(F)c4o3)CC[C@H]2C)c1 |
| InChI | InChI=1S/C23H21F2N5O2/c1-13-9-16(12-31)21(30-26-7-8-27-30)19(10-13)29-11-15(4-3-14(29)2)23-28-18-6-5-17(24)20(25)22(18)32-23/h5-10,12,14-15H,3-4,11H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | JZWCXHUUWPZWPL-HUUCEWRRSA-N |
| XLogP | 4.58 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|