C26H24ClF3N2O3 — CID 71502999
pyridin-3-ylmethyl 4-[2-chloro-3-(trifluoromethyl)phenyl]-2,6,6-trimethyl-5-oxo-1,4,7,8-tetrahydroquinoline-3-carboxylate (PubChem CID 71502999) has the molecular formula C26H24ClF3N2O3 and a molecular weight of 504.94 g/mol. Its IUPAC name is pyridin-3-ylmethyl 4-[2-chloro-3-(trifluoromethyl)phenyl]-2,6,6-trimethyl-5-oxo-1,4,7,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | pyridin-3-ylmethyl 4-[2-chloro-3-(trifluoromethyl)phenyl]-2,6,6-trimethyl-5-oxo-1,4,7,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 71502999 |
| Molecular Formula | C26H24ClF3N2O3 |
| Molecular Weight | 504.94 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | pyridin-3-ylmethyl 4-[2-chloro-3-(trifluoromethyl)phenyl]-2,6,6-trimethyl-5-oxo-1,4,7,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CC1=C(C(=O)OCc2cccnc2)C(c2cccc(C(F)(F)F)c2Cl)C2=C(CCC(C)(C)C2=O)N1 |
| InChI | InChI=1S/C26H24ClF3N2O3/c1-14-19(24(34)35-13-15-6-5-11-31-12-15)20(16-7-4-8-17(22(16)27)26(28,29)30)21-18(32-14)9-10-25(2,3)23(21)33/h4-8,11-12,20,32H,9-10,13H2,1-3H3 |
| InChIKey | COTUONGEKYOBTQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.94 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |