C13H13Cl3N2O — CID 71503614
3-(3-chloropropoxy)-1-(3,4-dichlorophenyl)-5-methylpyrazole (PubChem CID 71503614) has the molecular formula C13H13Cl3N2O and a molecular weight of 319.62 g/mol. Its IUPAC name is 3-(3-chloropropoxy)-1-(3,4-dichlorophenyl)-5-methylpyrazole.
| Compound Name | 3-(3-chloropropoxy)-1-(3,4-dichlorophenyl)-5-methylpyrazole |
|---|---|
| PubChem CID | 71503614 |
| Molecular Formula | C13H13Cl3N2O |
| Molecular Weight | 319.62 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 3-(3-chloropropoxy)-1-(3,4-dichlorophenyl)-5-methylpyrazole |
| SMILES | Cc1cc(OCCCCl)nn1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl3N2O/c1-9-7-13(19-6-2-5-14)17-18(9)10-3-4-11(15)12(16)8-10/h3-4,7-8H,2,5-6H2,1H3 |
| InChIKey | KOEIQCUICJVEIX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|