About dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate
dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate (PubChem CID 71503739) has the molecular formula C18H35NO5Si
and a molecular weight of 373.57 g/mol. Its IUPAC name is dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate |
| PubChem CID | 71503739 |
| Molecular Formula | C18H35NO5Si |
| Molecular Weight | 373.57 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)CCN1C(=O)OC |
| InChI | InChI=1S/C18H35NO5Si/c1-12(2)25(13(3)4,14(5)6)24-15-9-10-19(18(21)23-8)16(11-15)17(20)22-7/h12-16H,9-11H2,1-8H3/t15-,16+/m1/s1 |
| InChIKey | FVHWJCSVBVLADV-CVEARBPZSA-N |
| XLogP | 3.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate?
The IUPAC name of dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate (CID 71503739) is dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate.
What is the SMILES notation for dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate?
The canonical SMILES for dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate is COC(=O)[C@@H]1C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)CCN1C(=O)OC.
What is the InChIKey of dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate?
The InChIKey is FVHWJCSVBVLADV-CVEARBPZSA-N. The full InChI is InChI=1S/C18H35NO5Si/c1-12(2)25(13(3)4,14(5)6)24-15-9-10-19(18(21)23-8)16(11-15)17(20)22-7/h12-16H,9-11H2,1-8H3/t15-,16+/m1/s1.
What are the key properties of dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate?
dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate has a molecular weight of 373.57 g/mol, XLogP of 3.95, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2S,4R)-4-tri(propan-2-yl)silyloxypiperidine-1,2-dicarboxylate is sourced from PubChem (CID 71503739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).