C12H21NO3 — CID 71503745
methyl (1R,2R,3E,5R)-3-hydroxyimino-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate (PubChem CID 71503745) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is methyl (1R,2R,3E,5R)-3-hydroxyimino-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate.
| Compound Name | methyl (1R,2R,3E,5R)-3-hydroxyimino-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 71503745 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | methyl (1R,2R,3E,5R)-3-hydroxyimino-5-methyl-2-propan-2-ylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](C)C/C(=N\O)[C@@H]1C(C)C |
| InChI | InChI=1S/C12H21NO3/c1-7(2)11-9(12(14)16-4)5-8(3)6-10(11)13-15/h7-9,11,15H,5-6H2,1-4H3/b13-10+/t8-,9-,11-/m1/s1 |
| InChIKey | UJMBXEZJUKWFPI-MENJWJSWSA-N |
| XLogP | 2.31 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|