About 3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine
3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 71503747) has the molecular formula C15H24F3N3
and a molecular weight of 303.37 g/mol. Its IUPAC name is 3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine |
| PubChem CID | 71503747 |
| Molecular Formula | C15H24F3N3 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCCCN(CCCC)c1nc(C(F)(F)F)ccc1CN |
| InChI | InChI=1S/C15H24F3N3/c1-3-5-9-21(10-6-4-2)14-12(11-19)7-8-13(20-14)15(16,17)18/h7-8H,3-6,9-11,19H2,1-2H3 |
| InChIKey | LWGHVGCVYQKUKP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine?
The IUPAC name of 3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine (CID 71503747) is 3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine.
What is the SMILES notation for 3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine?
The canonical SMILES for 3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine is CCCCN(CCCC)c1nc(C(F)(F)F)ccc1CN.
What is the InChIKey of 3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine?
The InChIKey is LWGHVGCVYQKUKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24F3N3/c1-3-5-9-21(10-6-4-2)14-12(11-19)7-8-13(20-14)15(16,17)18/h7-8H,3-6,9-11,19H2,1-2H3.
What are the key properties of 3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine?
3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine has a molecular weight of 303.37 g/mol, XLogP of 3.97, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-N,N-dibutyl-6-(trifluoromethyl)pyridin-2-amine is sourced from PubChem (CID 71503747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).