C16H23NO — CID 71504107
(2S,4R)-6,8-dimethyl-2-(2-methylprop-1-enyl)-2,3,4,5-tetrahydro-1H-1-benzazepin-4-ol (PubChem CID 71504107) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (2S,4R)-6,8-dimethyl-2-(2-methylprop-1-enyl)-2,3,4,5-tetrahydro-1H-1-benzazepin-4-ol.
| Compound Name | (2S,4R)-6,8-dimethyl-2-(2-methylprop-1-enyl)-2,3,4,5-tetrahydro-1H-1-benzazepin-4-ol |
|---|---|
| PubChem CID | 71504107 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (2S,4R)-6,8-dimethyl-2-(2-methylprop-1-enyl)-2,3,4,5-tetrahydro-1H-1-benzazepin-4-ol |
| SMILES | CC(C)=C[C@@H]1C[C@H](O)Cc2c(C)cc(C)cc2N1 |
| InChI | InChI=1S/C16H23NO/c1-10(2)5-13-8-14(18)9-15-12(4)6-11(3)7-16(15)17-13/h5-7,13-14,17-18H,8-9H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | VZGBZAVZADHHLF-KGLIPLIRSA-N |
| XLogP | 3.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|