C28H23N3O3 — CID 71504659
(6S,6aR,10aR)-7-amino-10-methyl-6-(4-methylphenyl)-6a-nitro-9-phenyl-6,10a-dihydrobenzo[c]chromene-8-carbonitrile (PubChem CID 71504659) has the molecular formula C28H23N3O3 and a molecular weight of 449.51 g/mol. Its IUPAC name is (6S,6aR,10aR)-7-amino-10-methyl-6-(4-methylphenyl)-6a-nitro-9-phenyl-6,10a-dihydrobenzo[c]chromene-8-carbonitrile.
| Compound Name | (6S,6aR,10aR)-7-amino-10-methyl-6-(4-methylphenyl)-6a-nitro-9-phenyl-6,10a-dihydrobenzo[c]chromene-8-carbonitrile |
|---|---|
| PubChem CID | 71504659 |
| Molecular Formula | C28H23N3O3 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | (6S,6aR,10aR)-7-amino-10-methyl-6-(4-methylphenyl)-6a-nitro-9-phenyl-6,10a-dihydrobenzo[c]chromene-8-carbonitrile |
| SMILES | CC1=C(c2ccccc2)C(C#N)=C(N)[C@]2([N+](=O)[O-])[C@H]1c1ccccc1O[C@H]2c1ccc(C)cc1 |
| InChI | InChI=1S/C28H23N3O3/c1-17-12-14-20(15-13-17)27-28(31(32)33)25(21-10-6-7-11-23(21)34-27)18(2)24(22(16-29)26(28)30)19-8-4-3-5-9-19/h3-15,25,27H,30H2,1-2H3/t25-,27+,28-/m1/s1 |
| InChIKey | AYYCVMTVUHOFQS-FPNNDXFKSA-N |
| XLogP | 5.45 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|