C22H23F4N3OS — CID 71504787
2-[2,5-dimethyl-4-[[3-(2,3,5,6-tetrafluoro-4-methylphenyl)-1,2,4-thiadiazol-5-yl]oxy]phenyl]-N-ethyl-N-methylethanamine (PubChem CID 71504787) has the molecular formula C22H23F4N3OS and a molecular weight of 453.51 g/mol. Its IUPAC name is 2-[2,5-dimethyl-4-[[3-(2,3,5,6-tetrafluoro-4-methylphenyl)-1,2,4-thiadiazol-5-yl]oxy]phenyl]-N-ethyl-N-methylethanamine.
| Compound Name | 2-[2,5-dimethyl-4-[[3-(2,3,5,6-tetrafluoro-4-methylphenyl)-1,2,4-thiadiazol-5-yl]oxy]phenyl]-N-ethyl-N-methylethanamine |
|---|---|
| PubChem CID | 71504787 |
| Molecular Formula | C22H23F4N3OS |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 2-[2,5-dimethyl-4-[[3-(2,3,5,6-tetrafluoro-4-methylphenyl)-1,2,4-thiadiazol-5-yl]oxy]phenyl]-N-ethyl-N-methylethanamine |
| SMILES | CCN(C)CCc1cc(C)c(Oc2nc(-c3c(F)c(F)c(C)c(F)c3F)ns2)cc1C |
| InChI | InChI=1S/C22H23F4N3OS/c1-6-29(5)8-7-14-9-12(3)15(10-11(14)2)30-22-27-21(28-31-22)16-19(25)17(23)13(4)18(24)20(16)26/h9-10H,6-8H2,1-5H3 |
| InChIKey | GUHWWXARILHMRK-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|