C15H11ClN2S — CID 71504910
2-(4-chlorophenyl)-5-(4-methylphenyl)-1,3,4-thiadiazole (PubChem CID 71504910) has the molecular formula C15H11ClN2S and a molecular weight of 286.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-(4-methylphenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(4-chlorophenyl)-5-(4-methylphenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 71504910 |
| Molecular Formula | C15H11ClN2S |
| Molecular Weight | 286.79 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2-(4-chlorophenyl)-5-(4-methylphenyl)-1,3,4-thiadiazole |
| SMILES | Cc1ccc(-c2nnc(-c3ccc(Cl)cc3)s2)cc1 |
| InChI | InChI=1S/C15H11ClN2S/c1-10-2-4-11(5-3-10)14-17-18-15(19-14)12-6-8-13(16)9-7-12/h2-9H,1H3 |
| InChIKey | GHFJCYULWKPSAZ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.79 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |