C25H33NO8 — CID 71506030
(E)-6-[4-[4-(diethylamino)-4-oxobutanoyl]oxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid (PubChem CID 71506030) has the molecular formula C25H33NO8 and a molecular weight of 475.54 g/mol. Its IUPAC name is (E)-6-[4-[4-(diethylamino)-4-oxobutanoyl]oxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid.
| Compound Name | (E)-6-[4-[4-(diethylamino)-4-oxobutanoyl]oxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 71506030 |
| Molecular Formula | C25H33NO8 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | (E)-6-[4-[4-(diethylamino)-4-oxobutanoyl]oxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
| SMILES | CCN(CC)C(=O)CCC(=O)Oc1c(C/C=C(\C)CCC(=O)O)c(OC)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C25H33NO8/c1-6-26(7-2)19(27)11-13-21(30)34-24-17(10-8-15(3)9-12-20(28)29)23(32-5)16(4)18-14-33-25(31)22(18)24/h8H,6-7,9-14H2,1-5H3,(H,28,29)/b15-8+ |
| InChIKey | BLMWIHWLOYUHSC-OVCLIPMQSA-N |
| XLogP | 3.58 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|