C16H29N — CID 71506067
(5S,7R)-2,2-diethyl-N,N-dimethyladamantan-1-amine (PubChem CID 71506067) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (5S,7R)-2,2-diethyl-N,N-dimethyladamantan-1-amine.
| Compound Name | (5S,7R)-2,2-diethyl-N,N-dimethyladamantan-1-amine |
|---|---|
| PubChem CID | 71506067 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (5S,7R)-2,2-diethyl-N,N-dimethyladamantan-1-amine |
| SMILES | CCC1(CC)C2C[C@@H]3C[C@H](C2)CC1(N(C)C)C3 |
| InChI | InChI=1S/C16H29N/c1-5-15(6-2)14-8-12-7-13(9-14)11-16(15,10-12)17(3)4/h12-14H,5-11H2,1-4H3/t12-,13+,14?,16? |
| InChIKey | UJOAOIJAOPUIOZ-KKNUOHPOSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |