C20H14ClN5OS — CID 71506429
4-[2-[4-(6-chloro-3-pyridinyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidin-5-yl]-1,3-thiazol-4-yl]benzonitrile (PubChem CID 71506429) has the molecular formula C20H14ClN5OS and a molecular weight of 407.89 g/mol. Its IUPAC name is 4-[2-[4-(6-chloro-3-pyridinyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidin-5-yl]-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-[4-(6-chloro-3-pyridinyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidin-5-yl]-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 71506429 |
| Molecular Formula | C20H14ClN5OS |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 4-[2-[4-(6-chloro-3-pyridinyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidin-5-yl]-1,3-thiazol-4-yl]benzonitrile |
| SMILES | CC1=C(c2nc(-c3ccc(C#N)cc3)cs2)C(c2ccc(Cl)nc2)NC(=O)N1 |
| InChI | InChI=1S/C20H14ClN5OS/c1-11-17(18(26-20(27)24-11)14-6-7-16(21)23-9-14)19-25-15(10-28-19)13-4-2-12(8-22)3-5-13/h2-7,9-10,18H,1H3,(H2,24,26,27) |
| InChIKey | URZXRDLIESBEPT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|