C19H19N3O4S — CID 71506852
3-(4-methoxy-1-benzofuran-2-yl)-6-(3-methylsulfinylpropoxy)imidazo[1,2-b]pyridazine (PubChem CID 71506852) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is 3-(4-methoxy-1-benzofuran-2-yl)-6-(3-methylsulfinylpropoxy)imidazo[1,2-b]pyridazine.
| Compound Name | 3-(4-methoxy-1-benzofuran-2-yl)-6-(3-methylsulfinylpropoxy)imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 71506852 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 3-(4-methoxy-1-benzofuran-2-yl)-6-(3-methylsulfinylpropoxy)imidazo[1,2-b]pyridazine |
| SMILES | COc1cccc2oc(-c3cnc4ccc(OCCCS(C)=O)nn34)cc12 |
| InChI | InChI=1S/C19H19N3O4S/c1-24-15-5-3-6-16-13(15)11-17(26-16)14-12-20-18-7-8-19(21-22(14)18)25-9-4-10-27(2)23/h3,5-8,11-12H,4,9-10H2,1-2H3 |
| InChIKey | DTLCVMCGNBLCPO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|