C11H14O3 — CID 71506916
(5S,7R)-7-prop-2-enyl-1,6-dioxaspiro[4.5]dec-9-en-8-one (PubChem CID 71506916) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is (5S,7R)-7-prop-2-enyl-1,6-dioxaspiro[4.5]dec-9-en-8-one.
| Compound Name | (5S,7R)-7-prop-2-enyl-1,6-dioxaspiro[4.5]dec-9-en-8-one |
|---|---|
| PubChem CID | 71506916 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | (5S,7R)-7-prop-2-enyl-1,6-dioxaspiro[4.5]dec-9-en-8-one |
| SMILES | C=CC[C@H]1O[C@]2(C=CC1=O)CCCO2 |
| InChI | InChI=1S/C11H14O3/c1-2-4-10-9(12)5-7-11(14-10)6-3-8-13-11/h2,5,7,10H,1,3-4,6,8H2/t10-,11+/m1/s1 |
| InChIKey | LJEOASLTJHTGMI-MNOVXSKESA-N |
| XLogP | 1.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|