C11H16O3 — CID 71506917
(2R,4aS,8aS)-2-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one (PubChem CID 71506917) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2R,4aS,8aS)-2-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one.
| Compound Name | (2R,4aS,8aS)-2-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one |
|---|---|
| PubChem CID | 71506917 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (2R,4aS,8aS)-2-prop-2-enyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one |
| SMILES | C=CC[C@H]1O[C@H]2CCCO[C@H]2CC1=O |
| InChI | InChI=1S/C11H16O3/c1-2-4-9-8(12)7-11-10(14-9)5-3-6-13-11/h2,9-11H,1,3-7H2/t9-,10+,11+/m1/s1 |
| InChIKey | ZEKGTIZQWMGUHR-VWYCJHECSA-N |
| XLogP | 1.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|