C21H29N2OP — CID 71506980
trans-(1R,2R)-2-N-diphenylphosphoryl-1-N-propan-2-ylcyclohexane-1,2-diamine (PubChem CID 71506980) has the molecular formula C21H29N2OP and a molecular weight of 356.45 g/mol. Its IUPAC name is trans-(1R,2R)-2-N-diphenylphosphoryl-1-N-propan-2-ylcyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-2-N-diphenylphosphoryl-1-N-propan-2-ylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 71506980 |
| Molecular Formula | C21H29N2OP |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | trans-(1R,2R)-2-N-diphenylphosphoryl-1-N-propan-2-ylcyclohexane-1,2-diamine |
| SMILES | CC(C)N[C@@H]1CCCC[C@H]1NP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29N2OP/c1-17(2)22-20-15-9-10-16-21(20)23-25(24,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-8,11-14,17,20-22H,9-10,15-16H2,1-2H3,(H,23,24)/t20-,21-/m1/s1 |
| InChIKey | OIWYKGWZNGGGEB-NHCUHLMSSA-N |
| XLogP | 3.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|