C11H17NO5 — CID 71506996
(3aS,4S,5R,5aR,8aS,8bS)-2,2,7-trimethyl-3a,4,5,5a,8a,8b-hexahydro-[1,3]dioxolo[4,5-e][1,3]benzoxazole-4,5-diol (PubChem CID 71506996) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is (3aS,4S,5R,5aR,8aS,8bS)-2,2,7-trimethyl-3a,4,5,5a,8a,8b-hexahydro-[1,3]dioxolo[4,5-e][1,3]benzoxazole-4,5-diol.
| Compound Name | (3aS,4S,5R,5aR,8aS,8bS)-2,2,7-trimethyl-3a,4,5,5a,8a,8b-hexahydro-[1,3]dioxolo[4,5-e][1,3]benzoxazole-4,5-diol |
|---|---|
| PubChem CID | 71506996 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (3aS,4S,5R,5aR,8aS,8bS)-2,2,7-trimethyl-3a,4,5,5a,8a,8b-hexahydro-[1,3]dioxolo[4,5-e][1,3]benzoxazole-4,5-diol |
| SMILES | CC1=N[C@H]2[C@@H](O1)[C@H](O)[C@H](O)[C@@H]1OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C11H17NO5/c1-4-12-5-8(15-4)6(13)7(14)10-9(5)16-11(2,3)17-10/h5-10,13-14H,1-3H3/t5-,6+,7-,8+,9-,10-/m0/s1 |
| InChIKey | LUHKZZPOXDHRHQ-UFMRAMJRSA-N |
| XLogP | -0.57 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |