About N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide
N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide (PubChem CID 71507194) has the molecular formula C18H21N3O3
and a molecular weight of 327.38 g/mol. Its IUPAC name is N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide |
| PubChem CID | 71507194 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide |
| SMILES | CC1C(=O)n2c(cc3ccccc32)C(=O)N1CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H21N3O3/c1-11-16(23)21-13-8-6-5-7-12(13)9-14(21)17(24)20(11)10-15(22)19-18(2,3)4/h5-9,11H,10H2,1-4H3,(H,19,22) |
| InChIKey | LEIWITQVOPDCOB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide?
The IUPAC name of N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide (CID 71507194) is N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide.
What is the SMILES notation for N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide?
The canonical SMILES for N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide is CC1C(=O)n2c(cc3ccccc32)C(=O)N1CC(=O)NC(C)(C)C.
What is the InChIKey of N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide?
The InChIKey is LEIWITQVOPDCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O3/c1-11-16(23)21-13-8-6-5-7-12(13)9-14(21)17(24)20(11)10-15(22)19-18(2,3)4/h5-9,11H,10H2,1-4H3,(H,19,22).
What are the key properties of N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide?
N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide has a molecular weight of 327.38 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-(3-methyl-1,4-dioxo-3H-pyrazino[1,2-a]indol-2-yl)acetamide is sourced from PubChem (CID 71507194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).