C26H31NO5S — CID 71507241
(1R,6R,8S)-6-[(1S,2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-6-phenylsulfanyl-1,2,3,7-tetrahydropyrrolizine-1-carboxylic acid (PubChem CID 71507241) has the molecular formula C26H31NO5S and a molecular weight of 469.60 g/mol. Its IUPAC name is (1R,6R,8S)-6-[(1S,2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-6-phenylsulfanyl-1,2,3,7-tetrahydropyrrolizine-1-carboxylic acid.
| Compound Name | (1R,6R,8S)-6-[(1S,2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-6-phenylsulfanyl-1,2,3,7-tetrahydropyrrolizine-1-carboxylic acid |
|---|---|
| PubChem CID | 71507241 |
| Molecular Formula | C26H31NO5S |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | (1R,6R,8S)-6-[(1S,2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-8-hydroxy-5-oxo-6-phenylsulfanyl-1,2,3,7-tetrahydropyrrolizine-1-carboxylic acid |
| SMILES | C[C@H]1C=C[C@H]2CCCC[C@@H]2[C@H]1C(=O)[C@]1(Sc2ccccc2)C[C@]2(O)[C@H](C(=O)O)CCN2C1=O |
| InChI | InChI=1S/C26H31NO5S/c1-16-11-12-17-7-5-6-10-19(17)21(16)22(28)25(33-18-8-3-2-4-9-18)15-26(32)20(23(29)30)13-14-27(26)24(25)31/h2-4,8-9,11-12,16-17,19-21,32H,5-7,10,13-15H2,1H3,(H,29,30)/t16-,17+,19-,20-,21-,25+,26-/m0/s1 |
| InChIKey | YNJXQFVIMUWTEB-MQVMPIFCSA-N |
| XLogP | 3.74 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|