About 3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid
3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid (PubChem CID 71507359) has the molecular formula C13H18O5
and a molecular weight of 254.28 g/mol. Its IUPAC name is 3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid |
| PubChem CID | 71507359 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid |
| SMILES | CC(C)(C)OOC1(CCC(=O)O)C=CC(=O)C=C1 |
| InChI | InChI=1S/C13H18O5/c1-12(2,3)17-18-13(9-6-11(15)16)7-4-10(14)5-8-13/h4-5,7-8H,6,9H2,1-3H3,(H,15,16) |
| InChIKey | WIVMCSLGDZPLJK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid?
The IUPAC name of 3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid (CID 71507359) is 3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid.
What is the SMILES notation for 3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid?
The canonical SMILES for 3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid is CC(C)(C)OOC1(CCC(=O)O)C=CC(=O)C=C1.
What is the InChIKey of 3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid?
The InChIKey is WIVMCSLGDZPLJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O5/c1-12(2,3)17-18-13(9-6-11(15)16)7-4-10(14)5-8-13/h4-5,7-8H,6,9H2,1-3H3,(H,15,16).
What are the key properties of 3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid?
3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid has a molecular weight of 254.28 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-tert-butylperoxy-4-oxocyclohexa-2,5-dien-1-yl)propanoic acid is sourced from PubChem (CID 71507359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).