C13H12O4 — CID 71507378
(5R,7S,8S)-8-hydroxy-7-phenyl-1,6-dioxaspiro[4.4]non-3-en-2-one (PubChem CID 71507378) has the molecular formula C13H12O4 and a molecular weight of 232.24 g/mol. Its IUPAC name is (5R,7S,8S)-8-hydroxy-7-phenyl-1,6-dioxaspiro[4.4]non-3-en-2-one.
| Compound Name | (5R,7S,8S)-8-hydroxy-7-phenyl-1,6-dioxaspiro[4.4]non-3-en-2-one |
|---|---|
| PubChem CID | 71507378 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (5R,7S,8S)-8-hydroxy-7-phenyl-1,6-dioxaspiro[4.4]non-3-en-2-one |
| SMILES | O=C1C=C[C@@]2(C[C@H](O)[C@H](c3ccccc3)O2)O1 |
| InChI | InChI=1S/C13H12O4/c14-10-8-13(7-6-11(15)16-13)17-12(10)9-4-2-1-3-5-9/h1-7,10,12,14H,8H2/t10-,12-,13+/m0/s1 |
| InChIKey | HQBGZDWOMDYFLH-WCFLWFBJSA-N |
| XLogP | 1.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |