C9H10F6O5 — CID 71507424
(4R,5R)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 71507424) has the molecular formula C9H10F6O5 and a molecular weight of 312.16 g/mol. Its IUPAC name is (4R,5R)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4R,5R)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 71507424 |
| Molecular Formula | C9H10F6O5 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (4R,5R)-5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C)O[C@@H](C(O)(C(F)(F)F)C(F)(F)F)[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C9H10F6O5/c1-6(2)19-3(5(16)17)4(20-6)7(18,8(10,11)12)9(13,14)15/h3-4,18H,1-2H3,(H,16,17)/t3-,4-/m1/s1 |
| InChIKey | CCBBNSFPSWOGDN-QWWZWVQMSA-N |
| XLogP | 1.45 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |