C26H49BO3Si — CID 71507480
tert-butyl-dimethyl-[(2E,6R)-3-methyl-6-prop-1-en-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)deca-2,9-dienoxy]silane (PubChem CID 71507480) has the molecular formula C26H49BO3Si and a molecular weight of 448.57 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2E,6R)-3-methyl-6-prop-1-en-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)deca-2,9-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2E,6R)-3-methyl-6-prop-1-en-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)deca-2,9-dienoxy]silane |
|---|---|
| PubChem CID | 71507480 |
| Molecular Formula | C26H49BO3Si |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.35 |
| IUPAC Name | tert-butyl-dimethyl-[(2E,6R)-3-methyl-6-prop-1-en-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)deca-2,9-dienoxy]silane |
| SMILES | C=CCC[C@H](CC(B1OC(C)(C)C(C)(C)O1)/C(C)=C/CO[Si](C)(C)C(C)(C)C)C(=C)C |
| InChI | InChI=1S/C26H49BO3Si/c1-14-15-16-22(20(2)3)19-23(27-29-25(8,9)26(10,11)30-27)21(4)17-18-28-31(12,13)24(5,6)7/h14,17,22-23H,1-2,15-16,18-19H2,3-13H3/b21-17+/t22-,23?/m1/s1 |
| InChIKey | OAIQUJNNIOYODE-BZAWAROLSA-N |
| XLogP | 7.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|