C18H29BrO3Si — CID 71507486
(1R)-1-[(2S,3aS,5R,7Z,9aS)-5-[(1S)-1-bromopropyl]-3,3a,5,6,9,9a-hexahydro-2H-furo[3,2-b]oxocin-2-yl]-3-trimethylsilylprop-2-yn-1-ol (PubChem CID 71507486) has the molecular formula C18H29BrO3Si and a molecular weight of 401.42 g/mol. Its IUPAC name is (1R)-1-[(2S,3aS,5R,7Z,9aS)-5-[(1S)-1-bromopropyl]-3,3a,5,6,9,9a-hexahydro-2H-furo[3,2-b]oxocin-2-yl]-3-trimethylsilylprop-2-yn-1-ol.
| Compound Name | (1R)-1-[(2S,3aS,5R,7Z,9aS)-5-[(1S)-1-bromopropyl]-3,3a,5,6,9,9a-hexahydro-2H-furo[3,2-b]oxocin-2-yl]-3-trimethylsilylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 71507486 |
| Molecular Formula | C18H29BrO3Si |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (1R)-1-[(2S,3aS,5R,7Z,9aS)-5-[(1S)-1-bromopropyl]-3,3a,5,6,9,9a-hexahydro-2H-furo[3,2-b]oxocin-2-yl]-3-trimethylsilylprop-2-yn-1-ol |
| SMILES | CC[C@H](Br)[C@H]1C/C=C\C[C@@H]2O[C@H]([C@H](O)C#C[Si](C)(C)C)C[C@@H]2O1 |
| InChI | InChI=1S/C18H29BrO3Si/c1-5-13(19)15-8-6-7-9-16-18(21-15)12-17(22-16)14(20)10-11-23(2,3)4/h6-7,13-18,20H,5,8-9,12H2,1-4H3/b7-6-/t13-,14+,15+,16-,17-,18-/m0/s1 |
| InChIKey | DUFZZLHHXVMNIY-JVKBGJGESA-N |
| XLogP | 3.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|