About 4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid
4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid (PubChem CID 7150819) has the molecular formula C11H13N3O3S
and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid |
| PubChem CID | 7150819 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCCc1cn2ccsc2n1 |
| InChI | InChI=1S/C11H13N3O3S/c15-9(1-2-10(16)17)12-4-3-8-7-14-5-6-18-11(14)13-8/h5-7H,1-4H2,(H,12,15)(H,16,17) |
| InChIKey | GGXRURKZNPDNOU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid?
The IUPAC name of 4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid (CID 7150819) is 4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid.
What is the SMILES notation for 4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid?
The canonical SMILES for 4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid is O=C(O)CCC(=O)NCCc1cn2ccsc2n1.
What is the InChIKey of 4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid?
The InChIKey is GGXRURKZNPDNOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3S/c15-9(1-2-10(16)17)12-4-3-8-7-14-5-6-18-11(14)13-8/h5-7H,1-4H2,(H,12,15)(H,16,17).
What are the key properties of 4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid?
4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid has a molecular weight of 267.31 g/mol, XLogP of 0.92, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-imidazo[2,1-b][1,3]thiazol-6-ylethylamino)-4-oxobutanoic acid is sourced from PubChem (CID 7150819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).